Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z)
Modify Date: 2026-07-19 17:18:02
Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z) structure
|
Common Name | Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z) | ||
|---|---|---|---|---|
| CAS Number | 15620-61-8 | Molecular Weight | 276.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H28O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H28O2 |
|---|---|
| Molecular Weight | 276.4 |
| InChIKey | VTUGLPXNGDXVHC-LTKCOYKYSA-N |
| SMILES | CC=CCC=CCC=CCC=CCCCCC(=O)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z)? |
| A: Molecular weight of Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z) is 276.4. |
| Q: What is the SMILES notation of Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z)? |
| A: SMILES notation of Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z) is CC=CCC=CCC=CCC=CCCCCC(=O)OC. |
| Q: What is the InChIKey of Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z)? |
| A: InChIKey of Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z) is VTUGLPXNGDXVHC-LTKCOYKYSA-N. |
| Q: What is the molecular formula of Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z)? |
| A: Molecular formula of Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z) is C18H28O2. |
| Q: What is the CAS number of Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z)? |
| A: CAS number of Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z) is 15620-61-8. |
| Q: What is the English name of Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z)? |
| A: The English name of Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z) is Methyl 6,9,12,15-heptadecatetraenoate, (6Z,9Z,12Z,15Z). |
| Q: What is the Chinese name of 15620-61-8? |
| A: Chinese name of 15620-61-8 is 15620-61-8. |