Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate
Modify Date: 2026-07-31 12:21:07
Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate structure
|
Common Name | Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 1562318-07-3 | Molecular Weight | 241.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H23NO3 |
|---|---|
| Molecular Weight | 241.33 |
| InChIKey | MRWDCKFBNITRDP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=CCN1CCCC(OCC)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate? |
| A: Molecular weight of Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate is 241.33. |
| Q: What is the CAS number of Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate? |
| A: CAS number of Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate is 1562318-07-3. |
| Q: What is the SMILES notation of Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate? |
| A: SMILES notation of Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate is CCOC(=O)C=CCN1CCCC(OCC)C1. |
| Q: What is the InChIKey of Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate? |
| A: InChIKey of Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate is MRWDCKFBNITRDP-UHFFFAOYSA-N. |
| Q: What is the English name of Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate? |
| A: The English name of Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate is Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate. |
| Q: What is the molecular formula of Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate? |
| A: Molecular formula of Ethyl 4-(3-ethoxypiperidin-1-yl)but-2-enoate is C13H23NO3. |
| Q: What is the Chinese name of 1562318-07-3? |
| A: Chinese name of 1562318-07-3 is 1562318-07-3. |