1H-Imidazole-1-ethanol,5-nitro-2-(2-phenylethenyl)- structure
|
Common Name | 1H-Imidazole-1-ethanol,5-nitro-2-(2-phenylethenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1563-99-1 | Molecular Weight | 259.26100 | |
| Density | 1.27g/cm3 | Boiling Point | 518.9ºC at 760mmHg | |
| Molecular Formula | C13H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.6ºC | |
| Name | 2-[5-nitro-2-(2-phenylethenyl)imidazol-1-yl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 518.9ºC at 760mmHg |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26100 |
| Flash Point | 267.6ºC |
| Exact Mass | 259.09600 |
| PSA | 83.87000 |
| LogP | 2.47720 |
| Vapour Pressure | 1.36E-11mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | VPOIHQRBTSQBLC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc(C=Cc2ccccc2)n1CCO |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(5-nitro-2-styryl-1H-imidazol-1-yl)ethanol |
| 2-(5-nitro-2-styryl-imidazol-1-yl)-ethanol |
| 1H-Imidazole-1-ethanol,5-nitro-2-(2-phenylethenyl) |
| 2-[5-NITRO-2-(2-PHENYLVINYL)IMIDAZOL-1-YL]ETHANOL |
| Imidazole-1-ethanol,5-nitro-2-styryl-(7CI,8CI) |