1,1'-(Z)-ethene-1,2-diylbis(4-methoxybenzene) structure
|
Common Name | 1,1'-(Z)-ethene-1,2-diylbis(4-methoxybenzene) | ||
|---|---|---|---|---|
| CAS Number | 15638-14-9 | Molecular Weight | 240.297 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 391.3±11.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | 214ºC | |
| MSDS | N/A | Flash Point | 159.3±18.8 °C | |
| Name | 1-methoxy-4-[2-(4-methoxyphenyl)ethenyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 391.3±11.0 °C at 760 mmHg |
| Melting Point | 214ºC |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.297 |
| Flash Point | 159.3±18.8 °C |
| Exact Mass | 240.115036 |
| PSA | 18.46000 |
| LogP | 4.72 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | CAWFCZIEFIQKRV-ONEGZZNKSA-N |
| SMILES | COc1ccc(C=Cc2ccc(OC)cc2)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4,4'-DIMETHOXYSTILBENE |
| trans-4,4'-dimethoxy stilbene |
| 1,1'-[(Z)-1,2-Ethenediyl]bis(4-methoxybenzene) |
| 1,1'-(Z)-ethene-1,2-diylbis(4-methoxybenzene) |
| Benzene, 1,1'-[(Z)-1,2-ethenediyl]bis[4-methoxy- |
| 4,4'-DIMETHOXY-TRANS-STILBENE |