5(4H)-Oxazolone,4-[[4-(dimethylamino)phenyl]methylene]-2-phenyl structure
|
Common Name | 5(4H)-Oxazolone,4-[[4-(dimethylamino)phenyl]methylene]-2-phenyl | ||
|---|---|---|---|---|
| CAS Number | 1564-29-0 | Molecular Weight | 292.33200 | |
| Density | 1.14g/cm3 | Boiling Point | 451.7ºC at 760 mmHg | |
| Molecular Formula | C18H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227ºC | |
| Name | 4-[4-(Dimethylamino)benzylidene]-2-phenyl-2-oxazolin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 451.7ºC at 760 mmHg |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.33200 |
| Flash Point | 227ºC |
| Exact Mass | 292.12100 |
| PSA | 41.90000 |
| LogP | 2.53270 |
| Vapour Pressure | 2.37E-08mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | GVIKVHOLUBDIRH-FOWTUZBSSA-N |
| SMILES | CN(C)c1ccc(C=C2N=C(c3ccccc3)OC2=O)cc1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4-(4-dimethylamino-benzylidene)-2-phenyl-4H-oxazol-5-one |
| 4-[(p-N,N-dimethylamino)benzylidene]-2-phenyloxazole-5-one |
| LUMINORE ORANGE-RED 612 T |
| 4-(4-Dimethylaminobenzyliden)-2-phenyloxazolone-5 (Luminore orange-red 612 T ) |
| 4-(4'-N,N-dimethylaminobenzylidene)-2-phenyloxazole-5(4H)-one |
| Orange Red II |
| 4-[(4-dimethylaminophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one |
| 4-[4-(Dimethylamino)benzylidene]-2-phenyloxazole-5(4H)-one |
| 2-Phenyl-4-[p-(dimethylamino)benzylidene]-2-oxazoline-5-one |
| (Z/E)-4-[4-(dimethylamino)benzylidene]-2-phenyl-1,3-oxazol-5(4H)-one |
| 4-(4-N,N-dimethylaminobenzylylidene)-2-phenyloxazol-5(4H)-one |
| 4-[p-(Dimethylamino)benzylidene]-2-phenyl-2-oxazolin-5-one |
| 4-(4-dimethylaminobenzylidene)-2-phenyl-5(4H)-oxazolone |