ethyl 1-methyl-5-nitro-1H-imidazole-2-carboxylate structure
|
Common Name | ethyl 1-methyl-5-nitro-1H-imidazole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1564-49-4 | Molecular Weight | 199.16400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 1-methyl-5-nitroimidazole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H9N3O4 |
|---|---|
| Molecular Weight | 199.16400 |
| Exact Mass | 199.05900 |
| PSA | 89.94000 |
| LogP | 1.02820 |
| InChIKey | IFMBEWCVGFBHPO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ncc([N+](=O)[O-])n1C |
| HS Code | 2933290090 |
|---|
|
~0%
ethyl 1-methyl-... CAS#:1564-49-4 |
| Literature: Krowicki, Krzysztof; Lown, J. William Journal of Organic Chemistry, 1987 , vol. 52, # 16 p. 3493 - 3501 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 1-methyl-5-nitro-1H-imidazole-2-carboxylate |
| 1-Methyl-5-nitroimidazol-2-carbonsaeure-ethylester |
| 1-methyl-5-nitro-1H-imidazole-2-carboxylic acid ethyl ester |