9,10-Anthracenedione,1-amino-2-bromo-4-(phenylamino)- structure
|
Common Name | 9,10-Anthracenedione,1-amino-2-bromo-4-(phenylamino)- | ||
|---|---|---|---|---|
| CAS Number | 1564-71-2 | Molecular Weight | 393.23300 | |
| Density | 1.614g/cm3 | Boiling Point | 584.1ºC at 760mmHg | |
| Molecular Formula | C20H13BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.1ºC | |
| Name | 1-amino-4-anilino-2-bromoanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.614g/cm3 |
|---|---|
| Boiling Point | 584.1ºC at 760mmHg |
| Molecular Formula | C20H13BrN2O2 |
| Molecular Weight | 393.23300 |
| Flash Point | 307.1ºC |
| Exact Mass | 392.01600 |
| PSA | 72.19000 |
| LogP | 5.20450 |
| Vapour Pressure | 1.24E-13mmHg at 25°C |
| Index of Refraction | 1.757 |
| InChIKey | BMIJUARACLJZMP-UHFFFAOYSA-N |
| SMILES | Nc1c(Br)cc(Nc2ccccc2)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
|
~83%
9,10-Anthracene... CAS#:1564-71-2 |
| Literature: Ukponmwan; Greenhalgh; Peters Journal of Chemical and Engineering Data, 1984 , vol. 29, # 4 p. 482 - 483 |
|
~87%
9,10-Anthracene... CAS#:1564-71-2 |
| Literature: Philip, George; Nabar, U. T.; Kanetkar, V. R.; Sunthankar, S. V. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 8 p. 808 - 811 |
|
~%
9,10-Anthracene... CAS#:1564-71-2 |
| Literature: Friedlaender; Schick Chem. Zentralbl., 1904 , vol. 75, # II p. 339 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-Amino-2-brom-4-anilino-anthrachinon |
| 1-Amino-2-brom-4-phenylaminoanthrachinon |
| 1-Amino-2-bromo-4-(phenylamino)anthraquinone |
| 1-amino-2-bromo-4-anilinoanthraquinone |
| EINECS 216-361-4 |
| 1-Amino-4-anilino-2-brom-anthrachinon |
| 1-amino-4-anilino-2-bromo-anthraquinone |