Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl)
Modify Date: 2025-09-12 16:50:26
Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl) structure
|
Common Name | Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl) | ||
|---|---|---|---|---|
| CAS Number | 1564591-75-8 | Molecular Weight | 284.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18BrNO |
|---|---|
| Molecular Weight | 284.19 |
| InChIKey | AIDLCOBSLRHUHY-UHFFFAOYSA-N |
| SMILES | COCC(CNC1CC1)c1ccc(Br)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl)? |
| A: InChIKey of Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl) is AIDLCOBSLRHUHY-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1564591-75-8? |
| A: Chinese name of 1564591-75-8 is 1564591-75-8. |
| Q: What is the CAS number of Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl)? |
| A: CAS number of Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl) is 1564591-75-8. |
| Q: What is the molecular formula of Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl)? |
| A: Molecular formula of Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl) is C13H18BrNO. |
| Q: What is the SMILES notation of Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl)? |
| A: SMILES notation of Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl) is COCC(CNC1CC1)c1ccc(Br)cc1. |
| Q: What is the English name of Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl)? |
| A: The English name of Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl) is Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl). |
| Q: What is the molecular weight of Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl)? |
| A: Molecular weight of Benzeneethanamine, 4-bromo-N-cyclopropyl-I(2)-(methoxymethyl) is 284.19. |