4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine
Modify Date: 2026-07-16 12:14:39
![4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine Structure](https://www.chemsrc.com/extcaspic/044/1565519-91-6.png)
4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine structure
|
Common Name | 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine | ||
|---|---|---|---|---|
| CAS Number | 1565519-91-6 | Molecular Weight | 262.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14Cl2FN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14Cl2FN |
|---|---|
| Molecular Weight | 262.15 |
| InChIKey | KUQBUEFJWQBITF-UHFFFAOYSA-N |
| SMILES | FC1(Cc2ccc(Cl)c(Cl)c2)CCNCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine? |
| A: CAS number of 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine is 1565519-91-6. |
| Q: What is the InChIKey of 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine? |
| A: InChIKey of 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine is KUQBUEFJWQBITF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine? |
| A: Molecular formula of 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine is C12H14Cl2FN. |
| Q: What is the molecular weight of 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine? |
| A: Molecular weight of 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine is 262.15. |
| Q: What is the SMILES notation of 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine? |
| A: SMILES notation of 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine is FC1(Cc2ccc(Cl)c(Cl)c2)CCNCC1. |
| Q: What is the Chinese name of 1565519-91-6? |
| A: Chinese name of 1565519-91-6 is 1565519-91-6. |
| Q: What is the English name of 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine? |
| A: The English name of 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine is 4-[(3,4-Dichlorophenyl)methyl]-4-fluoropiperidine. |