BRD0418 structure
|
Common Name | BRD0418 | ||
|---|---|---|---|---|
| CAS Number | 1565827-99-7 | Molecular Weight | 488.58 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H32N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BRD0418Novel upregulator of TRIB1 expression, leading to reprogramming of hepatic lipoprotein metabolism from lipogenesis to scavenging |
| Name | BRD0418 |
|---|
| Description | Novel upregulator of TRIB1 expression, leading to reprogramming of hepatic lipoprotein metabolism from lipogenesis to scavenging |
|---|
| Molecular Formula | C29H32N2O5 |
|---|---|
| Molecular Weight | 488.58 |
| InChIKey | MRJCPWMBHXTRFB-HGAMEBRSSA-N |
| SMILES | CN(C)c1ccc2c(c1)C1CC(CC(=O)NCc3ccc(Oc4ccccc4)cc3)OC(CO)C1O2 |