Benzoic acid,2-[[[[3-(trifluoromethyl)phenyl]amino]carbonyl]amino]-, methyl ester structure
|
Common Name | Benzoic acid,2-[[[[3-(trifluoromethyl)phenyl]amino]carbonyl]amino]-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1566-98-9 | Molecular Weight | 338.28100 | |
| Density | 1.402g/cm3 | Boiling Point | 342.5ºC at 760 mmHg | |
| Molecular Formula | C16H13F3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161ºC | |
| Name | methyl 2-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzoate |
|---|
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 342.5ºC at 760 mmHg |
| Molecular Formula | C16H13F3N2O3 |
| Molecular Weight | 338.28100 |
| Flash Point | 161ºC |
| Exact Mass | 338.08800 |
| PSA | 67.43000 |
| LogP | 4.28200 |
| Vapour Pressure | 7.48E-05mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | GUDRLKWKZBPOOQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1NC(=O)Nc1cccc(C(F)(F)F)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |