(4-((4-Methoxybenzyl)oxy)phenyl)boronic acid structure
|
Common Name | (4-((4-Methoxybenzyl)oxy)phenyl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 156635-90-4 | Molecular Weight | 258.07700 | |
| Density | N/A | Boiling Point | 428.2°C at 760 mmHg | |
| Molecular Formula | C14H15BO4 | Melting Point | 174-178ºC | |
| MSDS | USA | Flash Point | 212.7°C | |
| Name | 4-(4-Methoxybenzyloxy)phenylboronic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 428.2°C at 760 mmHg |
|---|---|
| Melting Point | 174-178ºC |
| Molecular Formula | C14H15BO4 |
| Molecular Weight | 258.07700 |
| Flash Point | 212.7°C |
| Exact Mass | 258.10600 |
| PSA | 58.92000 |
| LogP | 0.95400 |
| InChIKey | UCYGEGISTWJFFA-UHFFFAOYSA-N |
| SMILES | COc1ccc(COc2ccc(B(O)O)cc2)cc1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [4-[(4-methoxyphenyl)methoxy]phenyl]boronic acid |
| (4-((4-Methoxybenzyl)oxy)phenyl)boronic acid |