Methyl 5-acetamido-2,4,7,8,9-penta-O-acetyl-3,5-dideoxy-3-(phenylthio)-D-erythro-β-L-gluco-2-nonulopyranosonate structure
|
Common Name | Methyl 5-acetamido-2,4,7,8,9-penta-O-acetyl-3,5-dideoxy-3-(phenylthio)-D-erythro-β-L-gluco-2-nonulopyranosonate | ||
|---|---|---|---|---|
| CAS Number | 156726-98-6 | Molecular Weight | 641.64100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H35NO14S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 5-acetamido-2,4,7,8,9-penta-O-acetyl-3,5-dideoxy-3-(phenylthio)-D-erythro-β-L-gluco-2-nonulopyranosonate |
|---|
| Molecular Formula | C28H35NO14S |
|---|---|
| Molecular Weight | 641.64100 |
| Exact Mass | 641.17800 |
| PSA | 221.43000 |
| LogP | 1.23230 |
| Vapour Pressure | 0mmHg at 25°C |
| InChIKey | NZFKVWJLAMASCK-KETAUXIUSA-N |
| SMILES | COC(=O)C1(OC(C)=O)OC(C(OC(C)=O)C(COC(C)=O)OC(C)=O)C(NC(C)=O)C(OC(C)=O)C1Sc1ccccc1 |
|
~%
Methyl 5-acetam... CAS#:156726-98-6 |
| Literature: Ercegovic, Teddy; Magnusson, Goeran Journal of the Chemical Society, Chemical Communications, 1994 , # 7 p. 831 - 832 |
|
~%
Methyl 5-acetam... CAS#:156726-98-6 |
| Literature: Ercegovic, Teddy; Magnusson, Goeran Journal of the Chemical Society, Chemical Communications, 1994 , # 7 p. 831 - 832 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |