hosenkoside E structure
|
Common Name | hosenkoside E | ||
|---|---|---|---|---|
| CAS Number | 156764-84-0 | Molecular Weight | 817.01 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H72O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of hosenkoside EHosenkoside E is a natural product that can be obtained from the seeds of Impatiens balsamina[1]. |
| Name | hosenkoside E |
|---|
| Description | Hosenkoside E is a natural product that can be obtained from the seeds of Impatiens balsamina[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C42H72O15 |
|---|---|
| Molecular Weight | 817.01 |
| Exact Mass | 816.48700 |
| PSA | 248.45000 |
| LogP | 0.19170 |
| InChIKey | QVZJCWCQCUEFLB-RURQOBFTSA-N |
| SMILES | CC(CO)C1CCC2(CCC3(C)C(CCC4C5(C)CCC(OC6OC(CO)C(O)C(O)C6OC6OC(CO)C(O)C(O)C6O)C(C)(CO)C5CCC43C)C2O)CO1 |