N-methyl-1-(3,4,5-trimethoxyphenyl)pent-4-en-2-amine structure
|
Common Name | N-methyl-1-(3,4,5-trimethoxyphenyl)pent-4-en-2-amine | ||
|---|---|---|---|---|
| CAS Number | 15686-23-4 | Molecular Weight | 265.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-methyl-1-(3,4,5-trimethoxyphenyl)pent-4-en-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H23NO3 |
|---|---|
| Molecular Weight | 265.34800 |
| Exact Mass | 265.16800 |
| PSA | 39.72000 |
| LogP | 2.80990 |
| InChIKey | BNRACCFKZQGPAB-UHFFFAOYSA-N |
| SMILES | C=CCC(Cc1cc(OC)c(OC)c(OC)c1)NC |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| UNII-4KZ5HJ5YHC |
| Trimoxamine |
| Trimoxamine [INN] |