6,6'-Methylenebis(4-chloro-2-isopropyl-5-methylphenol) structure
|
Common Name | 6,6'-Methylenebis(4-chloro-2-isopropyl-5-methylphenol) | ||
|---|---|---|---|---|
| CAS Number | 15686-33-6 | Molecular Weight | 381.33600 | |
| Density | 1.183g/cm3 | Boiling Point | 479ºC at 760mmHg | |
| Molecular Formula | C21H26Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.5ºC | |
| Name | 4-chloro-2-[(5-chloro-2-hydroxy-6-methyl-3-propan-2-ylphenyl)methyl]-3-methyl-6-propan-2-ylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 479ºC at 760mmHg |
| Molecular Formula | C21H26Cl2O2 |
| Molecular Weight | 381.33600 |
| Flash Point | 243.5ºC |
| Exact Mass | 380.13100 |
| PSA | 40.46000 |
| LogP | 6.85900 |
| Vapour Pressure | 8.48E-10mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | HNOOXWDWUSLXOB-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)cc(C(C)C)c(O)c1Cc1c(C)c(Cl)cc(C(C)C)c1O |
| HS Code | 2908199090 |
|---|
|
~%
6,6'-Methyleneb... CAS#:15686-33-6 |
| Literature: Journal of the American Chemical Society, , vol. 72, p. 837 |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| 2,2'-Methylen-bis-<4-chlor-3-methyl-6-isopropyl-phenol> |
| Biclotymolum [INN-Latin] |
| 2,2'-methylenebis(4-chloro-3-methyl-6-isopropylphenol) |
| 2,2'-methylenebis(4-chloro-6-isopropyl-3-methylphenol) |
| Hexaspray (TN) |
| Biclotymol |
| 4,4'-Dichlor-6,6'-diisopropyl-3,3'-dimethyl-2,2'-methandiyl-di-phenol |
| Biclotymolum |
| Biclotymol (INN) |
| UNII-W4K0AE8XW9 |
| 6,6'-Dichlor-2,2'-methylendithymol |
| 4,4'-dichloro-6,6'-diisopropyl-3,3'-dimethyl-2,2'-methanediyl-di-phenol |