2-(4-Chloro-3,5-dimethylphenoxy)acetohydrazide structure
|
Common Name | 2-(4-Chloro-3,5-dimethylphenoxy)acetohydrazide | ||
|---|---|---|---|---|
| CAS Number | 156867-62-8 | Molecular Weight | 228.67500 | |
| Density | 1.242g/cm3 | Boiling Point | 448.7ºC at 760 mmHg | |
| Molecular Formula | C10H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.2ºC | |
| Name | 2-(4-Chloro-3,5-dimethylphenoxy)acetohydrazide |
|---|
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 448.7ºC at 760 mmHg |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.67500 |
| Flash Point | 225.2ºC |
| Exact Mass | 228.06700 |
| PSA | 64.35000 |
| LogP | 2.41670 |
| Vapour Pressure | 3.04E-08mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | IESQBZMQMDXTCE-UHFFFAOYSA-N |
| SMILES | Cc1cc(OCC(=O)NN)cc(C)c1Cl |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |