α-Ethoxy-N-methyl-N-[2-[methyl(phenethyl)amino]ethyl]-α-phenylbenzeneacetamide structure
|
Common Name | α-Ethoxy-N-methyl-N-[2-[methyl(phenethyl)amino]ethyl]-α-phenylbenzeneacetamide | ||
|---|---|---|---|---|
| CAS Number | 15687-16-8 | Molecular Weight | 430.58200 | |
| Density | 1.084g/cm3 | Boiling Point | 566.3ºC at 760 mmHg | |
| Molecular Formula | C28H34N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.3ºC | |
| Name | 2-ethoxy-N-methyl-N-[2-[methyl(2-phenylethyl)amino]ethyl]-2,2-diphenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 566.3ºC at 760 mmHg |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.58200 |
| Flash Point | 296.3ºC |
| Exact Mass | 430.26200 |
| PSA | 32.78000 |
| LogP | 4.59960 |
| Vapour Pressure | 7.67E-13mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | NQIZDFMZAXUZCZ-UHFFFAOYSA-N |
| SMILES | CCOC(C(=O)N(C)CCN(C)CCc1ccccc1)(c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| UNII-NJQ5FL8Q43 |
| SQ 10,269 |
| Carbifenum |
| Etomide |
| N-Methyl-N-[2-(methyl-phenaethyl-amino)-aethyl]-2-aethoxy-2.2-diphenyl-acetamid |
| carbiphene |
| Carbifeno |