N-(tert-Butoxycarbonyl)-N-cyclopentylglycine structure
|
Common Name | N-(tert-Butoxycarbonyl)-N-cyclopentylglycine | ||
|---|---|---|---|---|
| CAS Number | 156881-63-9 | Molecular Weight | 243.299 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 393.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.8±23.2 °C | |
| Name | (2R)-2-cyclopentyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 393.5±25.0 °C at 760 mmHg |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.299 |
| Flash Point | 191.8±23.2 °C |
| Exact Mass | 243.147064 |
| PSA | 75.63000 |
| LogP | 2.60 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | WBSJQVRMQOLSAT-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C1CCCC1 |
| HS Code | 2924299090 |
|---|
|
~81%
N-(tert-Butoxyc... CAS#:156881-63-9 |
| Literature: Goodfellow, Val S.; Marathe, Manoj V.; Kuhlman, Karen G.; Fitzpatrick, Timothy D.; Cuadrado, David; Hanson, Wendy; Zuzack, John S.; Ross, Sherman E.; Wieczorek, Maciej; Burkard, Michael; Whalley, Eric T. Journal of Medicinal Chemistry, 1996 , vol. 39, # 7 p. 1472 - 1484 |
|
~%
N-(tert-Butoxyc... CAS#:156881-63-9 |
| Literature: Tetrahedron, , vol. 53, # 4 p. 1275 - 1294 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-D-Cyclopentylglycine |
| N-(tert-Butoxycarbonyl)-N-cyclopentylglycine |
| Cyclopentaneacetic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]-, (αR)- |
| N-Cyclopentyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycine |
| Glycine, N-cyclopentyl-N-[(1,1-dimethylethoxy)carbonyl]- |
| (Cyclopentyl{[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid |
| AmbotzBAA5130 |
| (2R)-Cyclopentyl({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid |
| Boc-D-Cpeg-OH |