(1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride
Modify Date: 2025-09-10 07:44:58
(1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride structure
|
Common Name | (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1569006-06-9 | Molecular Weight | 268.78 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H21ClN2O |
|---|---|
| Molecular Weight | 268.78 |
| InChIKey | WVIICFWQUBGVOO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)N2CCCNCC2)c(C)c1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride? |
| A: Molecular formula of (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride is C14H21ClN2O. |
| Q: What is the InChIKey of (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride? |
| A: InChIKey of (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride is WVIICFWQUBGVOO-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1569006-06-9? |
| A: Chinese name of 1569006-06-9 is 1569006-06-9. |
| Q: What is the CAS number of (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride? |
| A: CAS number of (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride is 1569006-06-9. |
| Q: What is the molecular weight of (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride? |
| A: Molecular weight of (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride is 268.78. |
| Q: What is the SMILES notation of (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride? |
| A: SMILES notation of (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride is Cc1ccc(C(=O)N2CCCNCC2)c(C)c1.Cl. |
| Q: What is the English name of (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride? |
| A: The English name of (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride is (1,4-Diazepan-1-yl)(2,4-dimethylphenyl)methanone hydrochloride. |