Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl)
Modify Date: 2025-09-07 13:36:05
Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl) structure
|
Common Name | Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl) | ||
|---|---|---|---|---|
| CAS Number | 156905-37-2 | Molecular Weight | 347.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H21N3O2 |
|---|---|
| Molecular Weight | 347.4 |
| InChIKey | HHBGHIVSLVXSQA-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)c3cccc4cc[nH]c34)CC2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl)? |
| A: Molecular formula of Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl) is C21H21N3O2. |
| Q: What is the SMILES notation of Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl)? |
| A: SMILES notation of Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl) is CC(=O)c1ccc(N2CCN(C(=O)c3cccc4cc[nH]c34)CC2)cc1. |
| Q: What is the English name of Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl)? |
| A: The English name of Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl) is Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl). |
| Q: What is the InChIKey of Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl)? |
| A: InChIKey of Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl) is HHBGHIVSLVXSQA-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 156905-37-2? |
| A: Chinese name of 156905-37-2 is 156905-37-2. |
| Q: What is the CAS number of Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl)? |
| A: CAS number of Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl) is 156905-37-2. |
| Q: What is the molecular weight of Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl)? |
| A: Molecular weight of Piperazine,1-(4-acetylphenyl)-4-(1h-indol-7-ylcarbonyl) is 347.4. |