N-((9H-fluoren-9-ylmethoxy)carbonyl)-N,O-dimethyl-L-Serine structure
|
Common Name | N-((9H-fluoren-9-ylmethoxy)carbonyl)-N,O-dimethyl-L-Serine | ||
|---|---|---|---|---|
| CAS Number | 1569103-64-5 | Molecular Weight | 355.38444 | |
| Density | 1.266±0.06 g/cm3(Predicted) | Boiling Point | 540.6±50.0 °C(Predicted) | |
| Molecular Formula | C20H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-((9H-fluoren-9-ylmethoxy)carbonyl)-N,O-dimethyl-L-SerineN-Fmoc-N,O-dimethyl-L-serine is a serine derivative that can be used for coibamide A synthesis. Coibamide A is a marine natural product with potent antiproliferative activity against human cancer cells[1][2]. |
| Name | (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}(methyl)amino)-3-methoxypropanoic acid |
|---|
| Description | N-Fmoc-N,O-dimethyl-L-serine is a serine derivative that can be used for coibamide A synthesis. Coibamide A is a marine natural product with potent antiproliferative activity against human cancer cells[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.266±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 540.6±50.0 °C(Predicted) |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.38444 |
| InChIKey | CTHCRMIWFPLNJK-SFHVURJKSA-N |
| SMILES | COCC(C(=O)O)N(C)C(=O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |