Benzobicyclon structure
|
Common Name | Benzobicyclon | ||
|---|---|---|---|---|
| CAS Number | 156963-66-5 | Molecular Weight | 446.96700 | |
| Density | 1.45 g/cm3 | Boiling Point | 651.1ºC at 760 mmHg | |
| Molecular Formula | C22H19ClO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.6ºC | |
Use of BenzobicyclonBenzobicyclon is a pro-herbicide, which acts as an inhibitor of 4-hydroxyphenylpyruvate dioxygenase (4-HPPD) in plant, and leads to bleaching and death[1]. |
| Name | benzobicyclon |
|---|---|
| Synonym | More Synonyms |
| Description | Benzobicyclon is a pro-herbicide, which acts as an inhibitor of 4-hydroxyphenylpyruvate dioxygenase (4-HPPD) in plant, and leads to bleaching and death[1]. |
|---|---|
| Related Catalog | |
| Target |
4-HPPD[1] |
| References |
| Density | 1.45 g/cm3 |
|---|---|
| Boiling Point | 651.1ºC at 760 mmHg |
| Molecular Formula | C22H19ClO4S2 |
| Molecular Weight | 446.96700 |
| Flash Point | 347.6ºC |
| Exact Mass | 446.04100 |
| PSA | 101.96000 |
| LogP | 6.05240 |
| Vapour Pressure | 7.81E-17mmHg at 25°C |
| Index of Refraction | 1.67 |
| InChIKey | VIXCLRUCUMWJFF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(C(=O)C2=C(Sc3ccccc3)C3CCC(C3)C2=O)c(Cl)c1 |
| Storage condition | 2-8°C |
| Benzobicyclon |
| Benzobicyclon [ISO] |
| 3-[2-chloro-4-(methylsulfonyl)benzoyl]-4-(phenylthio)bicyclo[3.2.1]oct-3-en-2-one |
| SB 500 (herbicide) |
| SB 500 |
| 3-(2-chloro-4-methylsulfonylbenzoyl)-2-phenylsulfanylbicyclo[3.2.1]oct-2-en-4-one |
| rac-(1R,5R)-3-[2-chloro-4-(methanesulfonyl)benzoyl]-4-(phenylsulfanyl)bicyclo[3.2.1]oct-3-en-2-one |
| 3-(2-chloro-4-mesylbenzoyl)-2-phenylthiobicyclo[3.2.1]oct-2-en-4-one |