Benzomalvin B structure
|
Common Name | Benzomalvin B | ||
|---|---|---|---|---|
| CAS Number | 157047-97-7 | Molecular Weight | 379.41100 | |
| Density | 1.28g/cm3 | Boiling Point | 612.1ºC at 760mmHg | |
| Molecular Formula | C24H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324ºC | |
Use of Benzomalvin BBenzomalvin B is the less active analogs of Benzomalvin A. Benzomalvin B is weakly active against substance P[1]. |
| Name | (7E)-7-benzylidene-6-methylquinazolino[3,2-a][1,4]benzodiazepine-5,13-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Benzomalvin B is the less active analogs of Benzomalvin A. Benzomalvin B is weakly active against substance P[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Benzomalvins B is weakly active against substance P with inhibition of 24% at a concentration of 100 µg/mL[1]. |
| References |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 612.1ºC at 760mmHg |
| Molecular Formula | C24H17N3O2 |
| Molecular Weight | 379.41100 |
| Flash Point | 324ºC |
| Exact Mass | 379.13200 |
| PSA | 56.37000 |
| LogP | 2.80950 |
| Vapour Pressure | 6.35E-15mmHg at 25°C |
| Index of Refraction | 1.687 |
| InChIKey | HXDZMNFJQNZXKW-RCCKNPSSSA-N |
| SMILES | CN1C(=O)c2ccccc2-n2c(nc3ccccc3c2=O)C1=Cc1ccccc1 |
| Benzomalvin B |