4,11-dichloro-5,6,12,13-tetrahydroquino[2,3-b]acridine-7,14-dione structure
|
Common Name | 4,11-dichloro-5,6,12,13-tetrahydroquino[2,3-b]acridine-7,14-dione | ||
|---|---|---|---|---|
| CAS Number | 15715-19-2 | Molecular Weight | 383.22700 | |
| Density | 1.59g/cm3 | Boiling Point | 605.7ºC at 760mmHg | |
| Molecular Formula | C20H12Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.1ºC | |
| Name | 4,11-dichloro-5,6,12,13-tetrahydroquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 605.7ºC at 760mmHg |
| Molecular Formula | C20H12Cl2N2O2 |
| Molecular Weight | 383.22700 |
| Flash Point | 320.1ºC |
| Exact Mass | 382.02800 |
| PSA | 65.72000 |
| LogP | 4.17140 |
| Vapour Pressure | 1.27E-14mmHg at 25°C |
| Index of Refraction | 1.754 |
| InChIKey | DDVFOLVGRBHZJB-UHFFFAOYSA-N |
| SMILES | O=c1c2c([nH]c3c(Cl)cccc13)Cc1c([nH]c3c(Cl)cccc3c1=O)C2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 239-804-3 |
| Quinacridone,4,11-dichloro-6,13-dihydro |
| 4,11-Dichlor-chinacridon |
| 4,11-Dichloro-5,6,12,13-tetrahydroquino(2,3-b)acridine-7,14-dione |
| Quino(2,3-b)acridine-7,14-dione,4,11-dichloro-5,6,12,13-tetrahydro |