1-Amino-1-trichlormethyl-2,2-dicyano-ethylen
1-Amino-1-trichlormethyl-2,2-dicyano-ethylen structure
|
Common Name | 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen | ||
|---|---|---|---|---|
| CAS Number | 1572-57-2 | Molecular Weight | 210.44800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H2Cl3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H2Cl3N3 |
|---|---|
| Molecular Weight | 210.44800 |
| Exact Mass | 208.93100 |
| PSA | 73.60000 |
| LogP | 2.31686 |
| InChIKey | XCHCMABVEJHUJZ-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)=C(N)C(Cl)(Cl)Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:1187-12-8
CAS#:74440-42-9
CAS#:93595-12-1![2-[amino(dimethylamino)methylidene]propanedinitrile structure](https://image.chemsrc.com/caspic/298/60025-21-0.png)
CAS#:60025-21-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-amino-4-trichloro-2-cyanocrotonate |
| (1-amino-2,2,2-trichloro-ethylidene)-malononitrile |
| 3-Amino-2-cyan-4,4,4-trichlor-crotonsaeurenitril |
| 2-Cyano-3-(trichlormethyl)-3-aminoacrylnitril |
| 1,1-Dicyano-2-amino-2-trichlormethylethylen |
| (1-AMINO-2,2,2-TRICHLOROETHYLIDINE)MALONITRILE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen? |
| A: SMILES notation of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen is N#CC(C#N)=C(N)C(Cl)(Cl)Cl. |
| Q: What is the LogP of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen? |
| A: LogP of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen is 2.31686. |
| Q: What English synonyms does 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen have? |
| A: English synonyms of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen: 3-amino-4-trichloro-2-cyanocrotonate, (1-amino-2,2,2-trichloro-ethylidene)-malononitrile, 3-Amino-2-cyan-4,4,4-trichlor-crotonsaeurenitril, 2-Cyano-3-(trichlormethyl)-3-aminoacrylnitril, 1,1-Dicyano-2-amino-2-trichlormethylethylen, (1-AMINO-2,2,2-TRICHLOROETHYLIDINE)MALONITRILE. |
| Q: What is the CAS number of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen? |
| A: CAS number of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen is 1572-57-2. |
| Q: What is the Chinese name of 1572-57-2? |
| A: Chinese name of 1572-57-2 is 1572-57-2. |
| Q: What are the downstream products of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen? |
| A: Related downstream products(CAS) of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen: 1187-12-8;74440-42-9;93595-12-1;60025-21-0. |
| Q: What is the molecular weight of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen? |
| A: Molecular weight of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen is 210.44800. |
| Q: What is the molecular formula of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen? |
| A: Molecular formula of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen is C5H2Cl3N3. |
| Q: What is the polar surface area (PSA) of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen? |
| A: Polar surface area (PSA) of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen is 73.60000. |
| Q: What is the InChIKey of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen? |
| A: InChIKey of 1-Amino-1-trichlormethyl-2,2-dicyano-ethylen is XCHCMABVEJHUJZ-UHFFFAOYSA-N. |