Trimethyl(2,3,4,5-tetrachlorophenyl)stannane structure
|
Common Name | Trimethyl(2,3,4,5-tetrachlorophenyl)stannane | ||
|---|---|---|---|---|
| CAS Number | 15725-06-1 | Molecular Weight | 378.68900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10Cl4Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-trimethylstannyl-2,3,4,5-tetrachlorobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H10Cl4Sn |
|---|---|
| Molecular Weight | 378.68900 |
| Exact Mass | 377.85600 |
| LogP | 4.84540 |
| InChIKey | MRNJBXPCRNWGNI-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)c1cc(Cl)c(Cl)c(Cl)c1Cl |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1-Trimethylstannyl-2,3,4,5-tetrachlor-benzol |