2-(2-Methoxybenzylidene)-3-oxobutyric acid ethyl ester structure
|
Common Name | 2-(2-Methoxybenzylidene)-3-oxobutyric acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 15725-24-3 | Molecular Weight | 248.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[(2-methoxyphenyl)methylidene]-3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16O4 |
|---|---|
| Molecular Weight | 248.27400 |
| Exact Mass | 248.10500 |
| PSA | 52.60000 |
| LogP | 2.23070 |
| InChIKey | GCWGJFJVTDRRNB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=Cc1ccccc1OC)C(C)=O |
| HS Code | 2918990090 |
|---|
|
~77%
2-(2-Methoxyben... CAS#:15725-24-3 |
| Literature: Nechepurenko; Shul'ts; Tolstikov Russian Journal of Organic Chemistry, 2001 , vol. 37, # 9 p. 1276 - 1283 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(2-Methoxybenzylidene)-3-oxobutyric acid ethyl ester |
| Butanoic acid,2-[(2-methoxyphenyl)methylene]-3-oxo-,ethyl ester |
| 2-(2-Methoxy-benzyliden)-acetessigester |
| 2-(2-Methoxy-benzyliden)-acetessigsaeure-aethylester |