4-Chloro-7-trifluoromethyl-quinoline-3-carbonitrile structure
|
Common Name | 4-Chloro-7-trifluoromethyl-quinoline-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 157301-81-0 | Molecular Weight | 256.61100 | |
| Density | 1.5g/cm3 | Boiling Point | 349.2ºC at 760mmHg | |
| Molecular Formula | C11H4ClF3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165ºC | |
| Name | 4-chloro-7-(trifluoromethyl)quinoline-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 349.2ºC at 760mmHg |
| Molecular Formula | C11H4ClF3N2 |
| Molecular Weight | 256.61100 |
| Flash Point | 165ºC |
| Exact Mass | 256.00200 |
| PSA | 36.68000 |
| LogP | 3.77868 |
| Vapour Pressure | 4.78E-05mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | AOFHTWFQIYUQSG-UHFFFAOYSA-N |
| SMILES | N#Cc1cnc2cc(C(F)(F)F)ccc2c1Cl |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-CHLORO-7-TRIFLUOROMETHYL-QUINOLINE-3-CARBONITRILE |
| 3-Quinolinecarbonitrile,4-chloro-7-(trifluoromethyl) |