1-propyl-2,3-dimethylimidazolium tetrafluoroborate structure
|
Common Name | 1-propyl-2,3-dimethylimidazolium tetrafluoroborate | ||
|---|---|---|---|---|
| CAS Number | 157310-72-0 | Molecular Weight | 226.02300 | |
| Density | 1.225g/mL | Boiling Point | N/A | |
| Molecular Formula | C8H15BF4N2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-propyl-2,3-dimethylimidazolium tetrafluoroborate |
|---|
| Density | 1.225g/mL |
|---|---|
| Molecular Formula | C8H15BF4N2+ |
| Molecular Weight | 226.02300 |
| Exact Mass | 226.12600 |
| PSA | 8.81000 |
| LogP | 2.33100 |
| InChIKey | VLYRTGGVSZQHBT-UHFFFAOYSA-N |
| SMILES | CCCn1cc[n+](C)c1C.F[B-](F)(F)F |
|
~%
1-propyl-2,3-di... CAS#:157310-72-0 |
| Literature: Ge, Ming-Lan; Ren, Xiao-Guang; Song, Yong-Ji; Wang, Li-Sheng Journal of Chemical and Engineering Data, 2009 , vol. 54, # 4 p. 1400 - 1402 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |