Bisphenol A difumarate
Modify Date: 2025-09-01 16:07:52
Bisphenol A difumarate structure
|
Common Name | Bisphenol A difumarate | ||
|---|---|---|---|---|
| CAS Number | 157378-43-3 | Molecular Weight | 424.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H20O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Bisphenol A difumarate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H20O8 |
|---|---|
| Molecular Weight | 424.4 |
| InChIKey | BZUBZNOPFVVIDU-PHEQNACWSA-N |
| SMILES | CC(C)(c1ccc(OC(=O)C=CC(=O)O)cc1)c1ccc(OC(=O)C=CC(=O)O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 157378-43-3? |
| A: Chinese name of 157378-43-3 is 157378-43-3. |
| Q: What is the molecular formula of Bisphenol A difumarate? |
| A: Molecular formula of Bisphenol A difumarate is C23H20O8. |
| Q: What is the molecular weight of Bisphenol A difumarate? |
| A: Molecular weight of Bisphenol A difumarate is 424.4. |
| Q: What is the InChIKey of Bisphenol A difumarate? |
| A: InChIKey of Bisphenol A difumarate is BZUBZNOPFVVIDU-PHEQNACWSA-N. |
| Q: What is the English name of Bisphenol A difumarate? |
| A: The English name of Bisphenol A difumarate is Bisphenol A difumarate. |
| Q: What is the SMILES notation of Bisphenol A difumarate? |
| A: SMILES notation of Bisphenol A difumarate is CC(C)(c1ccc(OC(=O)C=CC(=O)O)cc1)c1ccc(OC(=O)C=CC(=O)O)cc1. |
| Q: What is the CAS number of Bisphenol A difumarate? |
| A: CAS number of Bisphenol A difumarate is 157378-43-3. |