2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide
Modify Date: 2025-08-21 19:54:32
![2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide Structure](https://www.chemsrc.com/extcaspic/159/1574400-49-9.png)
2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide structure
|
Common Name | 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1574400-49-9 | Molecular Weight | 310.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15ClN2O2S |
|---|---|
| Molecular Weight | 310.8 |
| InChIKey | SWGKPGKDKPCNBY-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCNC(=O)c2nc(Cl)sc2C)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide? |
| A: SMILES notation of 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide is COc1ccc(CCNC(=O)c2nc(Cl)sc2C)cc1. |
| Q: What is the CAS number of 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide? |
| A: CAS number of 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide is 1574400-49-9. |
| Q: What is the Chinese name of 1574400-49-9? |
| A: Chinese name of 1574400-49-9 is 1574400-49-9. |
| Q: What is the InChIKey of 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide? |
| A: InChIKey of 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide is SWGKPGKDKPCNBY-UHFFFAOYSA-N. |
| Q: What is the English name of 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide? |
| A: The English name of 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide is 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide. |
| Q: What is the molecular formula of 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide? |
| A: Molecular formula of 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide is C14H15ClN2O2S. |
| Q: What is the molecular weight of 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide? |
| A: Molecular weight of 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5-methyl-1,3-thiazole-4-carboxamide is 310.8. |