C13H21ClN4O3S2
Modify Date: 2025-09-23 15:05:16
C13H21ClN4O3S2 structure
|
Common Name | C13H21ClN4O3S2 | ||
|---|---|---|---|---|
| CAS Number | 1574411-22-5 | Molecular Weight | 380.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21ClN4O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | C13H21ClN4O3S2 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H21ClN4O3S2 |
|---|---|
| Molecular Weight | 380.9 |
| InChIKey | IUDPNHBZFNWIAK-UHFFFAOYSA-N |
| SMILES | CC(C)c1sc(Cl)nc1C(=O)N1CCN(S(=O)(=O)N(C)C)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of C13H21ClN4O3S2? |
| A: SMILES notation of C13H21ClN4O3S2 is CC(C)c1sc(Cl)nc1C(=O)N1CCN(S(=O)(=O)N(C)C)CC1. |
| Q: What is the Chinese name of 1574411-22-5? |
| A: Chinese name of 1574411-22-5 is 1574411-22-5. |
| Q: What is the molecular formula of C13H21ClN4O3S2? |
| A: Molecular formula of C13H21ClN4O3S2 is C13H21ClN4O3S2. |
| Q: What is the English name of C13H21ClN4O3S2? |
| A: The English name of C13H21ClN4O3S2 is C13H21ClN4O3S2. |
| Q: What is the CAS number of C13H21ClN4O3S2? |
| A: CAS number of C13H21ClN4O3S2 is 1574411-22-5. |
| Q: What is the InChIKey of C13H21ClN4O3S2? |
| A: InChIKey of C13H21ClN4O3S2 is IUDPNHBZFNWIAK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of C13H21ClN4O3S2? |
| A: Molecular weight of C13H21ClN4O3S2 is 380.9. |