C13H20ClN3O2S
Modify Date: 2025-11-07 20:05:42
C13H20ClN3O2S structure
|
Common Name | C13H20ClN3O2S | ||
|---|---|---|---|---|
| CAS Number | 1574412-24-0 | Molecular Weight | 317.84 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20ClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | C13H20ClN3O2S |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H20ClN3O2S |
|---|---|
| Molecular Weight | 317.84 |
| InChIKey | CMZFBYFDQTUGGP-UHFFFAOYSA-N |
| SMILES | CC(C)c1sc(Cl)nc1C(=O)NCCN1CCOCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of C13H20ClN3O2S? |
| A: The English name of C13H20ClN3O2S is C13H20ClN3O2S. |
| Q: What is the molecular weight of C13H20ClN3O2S? |
| A: Molecular weight of C13H20ClN3O2S is 317.84. |
| Q: What is the molecular formula of C13H20ClN3O2S? |
| A: Molecular formula of C13H20ClN3O2S is C13H20ClN3O2S. |
| Q: What is the SMILES notation of C13H20ClN3O2S? |
| A: SMILES notation of C13H20ClN3O2S is CC(C)c1sc(Cl)nc1C(=O)NCCN1CCOCC1. |
| Q: What is the CAS number of C13H20ClN3O2S? |
| A: CAS number of C13H20ClN3O2S is 1574412-24-0. |
| Q: What is the InChIKey of C13H20ClN3O2S? |
| A: InChIKey of C13H20ClN3O2S is CMZFBYFDQTUGGP-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1574412-24-0? |
| A: Chinese name of 1574412-24-0 is 1574412-24-0. |