1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide
Modify Date: 2026-07-01 15:28:15
1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide structure
|
Common Name | 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1574463-60-7 | Molecular Weight | 435.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H25N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H25N3O3S |
|---|---|
| Molecular Weight | 435.5 |
| InChIKey | MEZMWUSOOAIAOO-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)C2CN(C(c3ccccc3)c3ccccc3)C2)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Primary screen in NF54 nanoGlo assay, in single point, at 2uM, 72h
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL4888485
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide? |
| A: Molecular weight of 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide is 435.5. |
| Q: What is the molecular formula of 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide? |
| A: Molecular formula of 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide is C24H25N3O3S. |
| Q: What is the CAS number of 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide? |
| A: CAS number of 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide is 1574463-60-7. |
| Q: What is the InChIKey of 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide? |
| A: InChIKey of 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide is MEZMWUSOOAIAOO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide? |
| A: SMILES notation of 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide is NS(=O)(=O)c1ccc(CNC(=O)C2CN(C(c3ccccc3)c3ccccc3)C2)cc1. |
| Q: What is the Chinese name of 1574463-60-7? |
| A: Chinese name of 1574463-60-7 is 1574463-60-7. |
| Q: What is the English name of 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide? |
| A: The English name of 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide is 1-(diphenylmethyl)-N-(4-sulfamoylbenzyl)azetidine-3-carboxamide. |