2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide
Modify Date: 2025-09-02 23:23:47
![2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide Structure](https://www.chemsrc.com/extcaspic/478/1574463-79-8.png)
2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide structure
|
Common Name | 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 1574463-79-8 | Molecular Weight | 357.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H19N3O5 |
|---|---|
| Molecular Weight | 357.4 |
| InChIKey | NQCHRALRDNDRGG-UHFFFAOYSA-N |
| SMILES | COc1cc2ncn(CC(=O)NCCc3ccco3)c(=O)c2cc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide? |
| A: Molecular weight of 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide is 357.4. |
| Q: What is the English name of 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide? |
| A: The English name of 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide is 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide. |
| Q: What is the Chinese name of 1574463-79-8? |
| A: Chinese name of 1574463-79-8 is 1574463-79-8. |
| Q: What is the CAS number of 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide? |
| A: CAS number of 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide is 1574463-79-8. |
| Q: What is the SMILES notation of 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide? |
| A: SMILES notation of 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide is COc1cc2ncn(CC(=O)NCCc3ccco3)c(=O)c2cc1OC. |
| Q: What is the molecular formula of 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide? |
| A: Molecular formula of 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide is C18H19N3O5. |
| Q: What is the InChIKey of 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide? |
| A: InChIKey of 2-(6,7-dimethoxy-4-oxoquinazolin-3(4H)-yl)-N-[2-(furan-2-yl)ethyl]acetamide is NQCHRALRDNDRGG-UHFFFAOYSA-N. |