2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine structure
|
Common Name | 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 1574466-16-2 | Molecular Weight | 368.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H24N4O3 |
|---|---|
| Molecular Weight | 368.4 |
| InChIKey | CWQRPJXHWNXBEH-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2ccnc3nc(C4CCCCC4)nn23)cc(OC)c1OC |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Primary qHTS assay for small molecule inhibitors of Inositol hexaphosphate kinase 1 (...
Source: NCGC
External Id: IP6K1-p1
|
|
Name: Primary qHTS assay for inhibitors of alpha-synuclein gene (SNCA) expression
Source: NCGC
External Id: SNCA-p-activity-luciferase
|
|
Name: Firefly luciferase inhibition profiling of diverse chemical library using quantitativ...
Source: NCGC
Target: N/A
External Id: CPF004
|
|
Name: Primary screen in NF54 nanoGlo assay, in single point, at 2uM, 72h
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL4888485
|
|
Name: Natriuretic polypeptide receptor (hNpr1) antagonism - Primary qHTS
Source: NCGC
Target: atrial natriuretic peptide receptor 1 [Homo sapiens]
External Id: hNprA-p1
|
|
Name: Cytotoxic Profiling in NIH 3T3 Cell Line of Diverse Libraries Using Quantitative High...
Source: NCGC
Target: N/A
External Id: CPF003
|
|
Name: Cytotoxic Profiling in HEK 293 Cell Line of Diverse Libraries Using Quantitative High...
Source: NCGC
Target: N/A
External Id: CPF002
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine? |
| A: InChIKey of 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine is CWQRPJXHWNXBEH-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine? |
| A: CAS number of 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine is 1574466-16-2. |
| Q: What is the molecular formula of 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine? |
| A: Molecular formula of 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine is C20H24N4O3. |
| Q: What is the SMILES notation of 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine? |
| A: SMILES notation of 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine is COc1cc(-c2ccnc3nc(C4CCCCC4)nn23)cc(OC)c1OC. |
| Q: What is the English name of 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine? |
| A: The English name of 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine is 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine. |
| Q: What is the Chinese name of 1574466-16-2? |
| A: Chinese name of 1574466-16-2 is 1574466-16-2. |
| Q: What is the molecular weight of 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine? |
| A: Molecular weight of 2-Cyclohexyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine is 368.4. |