2-(Thiophen-2-yl)-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine structure
|
Common Name | 2-(Thiophen-2-yl)-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 1574466-47-9 | Molecular Weight | 368.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(Thiophen-2-yl)-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine |
|---|
| Molecular Formula | C18H16N4O3S |
|---|---|
| Molecular Weight | 368.4 |
| InChIKey | PPDGCVHKVLIKGS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C2=CC=NC3=NC(=NN23)C4=CC=CS4 |
|
Name: Primary qHTS assay for small molecule inhibitors of Inositol hexaphosphate kinase 1 (...
Source: NCGC
External Id: IP6K1-p1
|
|
Name: Primary qHTS assay for inhibitors of alpha-synuclein gene (SNCA) expression
Source: NCGC
External Id: SNCA-p-activity-luciferase
|
|
Name: Firefly luciferase inhibition profiling of diverse chemical library using quantitativ...
Source: NCGC
Target: N/A
External Id: CPF004
|
|
Name: Natriuretic polypeptide receptor (hNpr1) antagonism - Primary qHTS
Source: NCGC
Target: atrial natriuretic peptide receptor 1 [Homo sapiens]
External Id: hNprA-p1
|
|
Name: Cytotoxic Profiling in NIH 3T3 Cell Line of Diverse Libraries Using Quantitative High...
Source: NCGC
Target: N/A
External Id: CPF003
|
|
Name: Cytotoxic Profiling in HEK 293 Cell Line of Diverse Libraries Using Quantitative High...
Source: NCGC
Target: N/A
External Id: CPF002
|