methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate
Modify Date: 2026-09-27 09:45:06
![methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate Structure](https://www.chemsrc.com/extcaspic/274/1574467-52-9.png)
methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate structure
|
Common Name | methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate | ||
|---|---|---|---|---|
| CAS Number | 1574467-52-9 | Molecular Weight | 303.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H17N3O4 |
|---|---|
| Molecular Weight | 303.31 |
| InChIKey | NBWSNILBOWZEPW-UHFFFAOYSA-N |
| SMILES | COC(=O)CCNC(=O)CCc1nc(-c2ccccc2)no1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate? |
| A: SMILES notation of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate is COC(=O)CCNC(=O)CCc1nc(-c2ccccc2)no1. |
| Q: What is the English name of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate? |
| A: The English name of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate is methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate. |
| Q: What is the CAS number of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate? |
| A: CAS number of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate is 1574467-52-9. |
| Q: What is the InChIKey of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate? |
| A: InChIKey of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate is NBWSNILBOWZEPW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate? |
| A: Molecular weight of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate is 303.31. |
| Q: What is the Chinese name of 1574467-52-9? |
| A: Chinese name of 1574467-52-9 is 1574467-52-9. |
| Q: What is the molecular formula of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate? |
| A: Molecular formula of methyl N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoyl]-beta-alaninate is C15H17N3O4. |