ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate
Modify Date: 2026-08-03 13:29:18
![ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate Structure](https://www.chemsrc.com/extcaspic/290/1574471-41-2.png)
ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate structure
|
Common Name | ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 1574471-41-2 | Molecular Weight | 400.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H20N4O4S |
|---|---|
| Molecular Weight | 400.5 |
| InChIKey | XWIGHZCMODZTLS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1csc(NC(=O)Cn2ccc3c(NC(C)=O)cccc32)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate? |
| A: Molecular formula of ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate is C19H20N4O4S. |
| Q: What is the InChIKey of ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate? |
| A: InChIKey of ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate is XWIGHZCMODZTLS-UHFFFAOYSA-N. |
| Q: What is the molecular weight of ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate? |
| A: Molecular weight of ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate is 400.5. |
| Q: What is the CAS number of ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate? |
| A: CAS number of ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate is 1574471-41-2. |
| Q: What is the SMILES notation of ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate? |
| A: SMILES notation of ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate is CCOC(=O)Cc1csc(NC(=O)Cn2ccc3c(NC(C)=O)cccc32)n1. |
| Q: What is the English name of ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate? |
| A: The English name of ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate is ethyl [2-({[4-(acetylamino)-1H-indol-1-yl]acetyl}amino)-1,3-thiazol-4-yl]acetate. |
| Q: What is the Chinese name of 1574471-41-2? |
| A: Chinese name of 1574471-41-2 is 1574471-41-2. |