3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one structure
|
Common Name | 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one | ||
|---|---|---|---|---|
| CAS Number | 1574472-81-3 | Molecular Weight | 379.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H25NO4 |
|---|---|
| Molecular Weight | 379.4 |
| InChIKey | QGXUOSOEAJOYDQ-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)CC(=O)N(CC(=O)c1ccc(C(C)C)cc1)C=C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1574472-81-3? |
| A: Chinese name of 1574472-81-3 is 1574472-81-3. |
| Q: What is the English name of 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one? |
| A: The English name of 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one is 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one. |
| Q: What is the InChIKey of 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one? |
| A: InChIKey of 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one is QGXUOSOEAJOYDQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one? |
| A: Molecular formula of 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one is C23H25NO4. |
| Q: What is the molecular weight of 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one? |
| A: Molecular weight of 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one is 379.4. |
| Q: What is the CAS number of 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one? |
| A: CAS number of 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one is 1574472-81-3. |
| Q: What is the SMILES notation of 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one? |
| A: SMILES notation of 3-[2-(4-isopropylphenyl)-2-oxoethyl]-7,8-dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one is COc1cc2c(cc1OC)CC(=O)N(CC(=O)c1ccc(C(C)C)cc1)C=C2. |