methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate
Modify Date: 2025-11-13 11:45:57
![methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate Structure](https://www.chemsrc.com/extcaspic/437/1574472-90-4.png)
methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate structure
|
Common Name | methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate | ||
|---|---|---|---|---|
| CAS Number | 1574472-90-4 | Molecular Weight | 305.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H15NO6 |
|---|---|
| Molecular Weight | 305.28 |
| InChIKey | XMSNMDGOLZGEIT-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC(=O)COc1ccc2c(C)cc(=O)oc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate? |
| A: Molecular formula of methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate is C15H15NO6. |
| Q: What is the English name of methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate? |
| A: The English name of methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate is methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate. |
| Q: What is the InChIKey of methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate? |
| A: InChIKey of methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate is XMSNMDGOLZGEIT-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate? |
| A: SMILES notation of methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate is COC(=O)CNC(=O)COc1ccc2c(C)cc(=O)oc2c1. |
| Q: What is the CAS number of methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate? |
| A: CAS number of methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate is 1574472-90-4. |
| Q: What is the molecular weight of methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate? |
| A: Molecular weight of methyl N-{[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}glycinate is 305.28. |
| Q: What is the Chinese name of 1574472-90-4? |
| A: Chinese name of 1574472-90-4 is 1574472-90-4. |