1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone
Modify Date: 2026-09-20 10:09:44
![1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone Structure](https://www.chemsrc.com/extcaspic/123/1574472-98-2.png)
1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone structure
|
Common Name | 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone | ||
|---|---|---|---|---|
| CAS Number | 1574472-98-2 | Molecular Weight | 334.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H22N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H22N4O |
|---|---|
| Molecular Weight | 334.4 |
| InChIKey | ZVNIXNXIUVZOKQ-UHFFFAOYSA-N |
| SMILES | O=C(c1c[nH]c2ccccc12)N1CCN(CCc2ccccn2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1574472-98-2? |
| A: Chinese name of 1574472-98-2 is 1574472-98-2. |
| Q: What is the InChIKey of 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone? |
| A: InChIKey of 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone is ZVNIXNXIUVZOKQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone? |
| A: CAS number of 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone is 1574472-98-2. |
| Q: What is the molecular formula of 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone? |
| A: Molecular formula of 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone is C20H22N4O. |
| Q: What is the English name of 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone? |
| A: The English name of 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone is 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone. |
| Q: What is the molecular weight of 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone? |
| A: Molecular weight of 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone is 334.4. |
| Q: What is the SMILES notation of 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone? |
| A: SMILES notation of 1H-indol-3-yl{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone is O=C(c1c[nH]c2ccccc12)N1CCN(CCc2ccccn2)CC1. |