N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide
Modify Date: 2025-08-26 13:17:26
N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide structure
|
Common Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 1574473-36-1 | Molecular Weight | 335.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H21N3O3S |
|---|---|
| Molecular Weight | 335.4 |
| InChIKey | BNXLNAWYQUHMMU-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)cc(=O)n1CCC(=O)Nc1nc(C(C)(C)C)cs1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide? |
| A: CAS number of N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide is 1574473-36-1. |
| Q: What is the English name of N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide? |
| A: The English name of N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide is N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide. |
| Q: What is the molecular weight of N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide? |
| A: Molecular weight of N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide is 335.4. |
| Q: What is the SMILES notation of N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide? |
| A: SMILES notation of N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide is Cc1cc(O)cc(=O)n1CCC(=O)Nc1nc(C(C)(C)C)cs1. |
| Q: What is the molecular formula of N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide? |
| A: Molecular formula of N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide is C16H21N3O3S. |
| Q: What is the Chinese name of 1574473-36-1? |
| A: Chinese name of 1574473-36-1 is 1574473-36-1. |
| Q: What is the InChIKey of N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide? |
| A: InChIKey of N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-hydroxy-6-methyl-2-oxopyridin-1(2H)-yl)propanamide is BNXLNAWYQUHMMU-UHFFFAOYSA-N. |