(4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone
Modify Date: 2026-07-15 17:40:38
(4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone structure
|
Common Name | (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 1574474-47-7 | Molecular Weight | 375.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H21N3O3 |
|---|---|
| Molecular Weight | 375.4 |
| InChIKey | HMCABWVUJLQWLT-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c2[nH]c(C(=O)N3CCc4c([nH]c5ccccc45)C3)cc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1574474-47-7? |
| A: Chinese name of 1574474-47-7 is 1574474-47-7. |
| Q: What is the InChIKey of (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone? |
| A: InChIKey of (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone is HMCABWVUJLQWLT-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone? |
| A: Molecular weight of (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone is 375.4. |
| Q: What is the molecular formula of (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone? |
| A: Molecular formula of (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone is C22H21N3O3. |
| Q: What is the CAS number of (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone? |
| A: CAS number of (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone is 1574474-47-7. |
| Q: What is the English name of (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone? |
| A: The English name of (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone is (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone. |
| Q: What is the SMILES notation of (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone? |
| A: SMILES notation of (4,7-dimethoxy-1H-indol-2-yl)(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)methanone is COc1ccc(OC)c2[nH]c(C(=O)N3CCc4c([nH]c5ccccc45)C3)cc12. |