N-(3-((6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)amino)-3-oxopropyl)pyrazine-2-carboxamide structure
|
Common Name | N-(3-((6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)amino)-3-oxopropyl)pyrazine-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1574479-15-4 | Molecular Weight | 381.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20FN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-((6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)amino)-3-oxopropyl)pyrazine-2-carboxamide |
|---|
| Molecular Formula | C20H20FN5O2 |
|---|---|
| Molecular Weight | 381.4 |
| InChIKey | DRSXCBBLLGHTDV-UHFFFAOYSA-N |
| SMILES | O=C(CCNC(=O)c1cnccn1)NC1CCCc2c1[nH]c1ccc(F)cc21 |
|
Name: Primary qHTS assay for small molecule inhibitors of Inositol hexaphosphate kinase 1 (...
Source: NCGC
External Id: IP6K1-p1
|
|
Name: Primary qHTS assay for inhibitors of alpha-synuclein gene (SNCA) expression
Source: NCGC
External Id: SNCA-p-activity-luciferase
|
|
Name: Firefly luciferase inhibition profiling of diverse chemical library using quantitativ...
Source: NCGC
Target: N/A
External Id: CPF004
|
|
Name: Natriuretic polypeptide receptor (hNpr1) antagonism - Primary qHTS
Source: NCGC
Target: atrial natriuretic peptide receptor 1 [Homo sapiens]
External Id: hNprA-p1
|
|
Name: Cytotoxic Profiling in NIH 3T3 Cell Line of Diverse Libraries Using Quantitative High...
Source: NCGC
Target: N/A
External Id: CPF003
|
|
Name: Cytotoxic Profiling in HEK 293 Cell Line of Diverse Libraries Using Quantitative High...
Source: NCGC
Target: N/A
External Id: CPF002
|