N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide
Modify Date: 2025-10-03 13:52:10
![N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide Structure](https://www.chemsrc.com/extcaspic/335/1574483-08-1.png)
N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide structure
|
Common Name | N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide | ||
|---|---|---|---|---|
| CAS Number | 1574483-08-1 | Molecular Weight | 317.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H19N3O2S |
|---|---|
| Molecular Weight | 317.4 |
| InChIKey | SEGOHQRBWHYHFM-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc2c1ccn2CC(=O)N1CCSCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1574483-08-1? |
| A: Chinese name of 1574483-08-1 is 1574483-08-1. |
| Q: What is the English name of N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide? |
| A: The English name of N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide is N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide. |
| Q: What is the InChIKey of N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide? |
| A: InChIKey of N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide is SEGOHQRBWHYHFM-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide? |
| A: CAS number of N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide is 1574483-08-1. |
| Q: What is the molecular formula of N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide? |
| A: Molecular formula of N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide is C16H19N3O2S. |
| Q: What is the SMILES notation of N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide? |
| A: SMILES notation of N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide is CC(=O)Nc1cccc2c1ccn2CC(=O)N1CCSCC1. |
| Q: What is the molecular weight of N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide? |
| A: Molecular weight of N-{1-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-1H-indol-4-yl}acetamide is 317.4. |