(1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone
Modify Date: 2025-09-03 18:54:46
![(1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone Structure](https://www.chemsrc.com/extcaspic/483/1574483-80-9.png)
(1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone structure
|
Common Name | (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone | ||
|---|---|---|---|---|
| CAS Number | 1574483-80-9 | Molecular Weight | 348.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H24N4O |
|---|---|
| Molecular Weight | 348.4 |
| InChIKey | ZAFJGXOWNMGZFL-UHFFFAOYSA-N |
| SMILES | Cn1c(C(=O)N2CCN(CCc3ccncc3)CC2)cc2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone? |
| A: The English name of (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone is (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone. |
| Q: What is the molecular formula of (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone? |
| A: Molecular formula of (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone is C21H24N4O. |
| Q: What is the Chinese name of 1574483-80-9? |
| A: Chinese name of 1574483-80-9 is 1574483-80-9. |
| Q: What is the molecular weight of (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone? |
| A: Molecular weight of (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone is 348.4. |
| Q: What is the InChIKey of (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone? |
| A: InChIKey of (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone is ZAFJGXOWNMGZFL-UHFFFAOYSA-N. |
| Q: What is the CAS number of (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone? |
| A: CAS number of (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone is 1574483-80-9. |
| Q: What is the SMILES notation of (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone? |
| A: SMILES notation of (1-methyl-1H-indol-2-yl){4-[2-(pyridin-4-yl)ethyl]piperazin-1-yl}methanone is Cn1c(C(=O)N2CCN(CCc3ccncc3)CC2)cc2ccccc21. |