N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide
Modify Date: 2026-06-19 21:11:34
N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide structure
|
Common Name | N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1574485-97-4 | Molecular Weight | 340.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20N8O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20N8O |
|---|---|
| Molecular Weight | 340.38 |
| InChIKey | ABPHAQKLCCGPQH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C)NC(=O)C2CCN(CC2)C3=NC=NC4=C3NC=N4 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Primary screen in NF54 nanoGlo assay, in single point, at 2uM, 72h
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL4888485
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide? |
| A: SMILES notation of N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide is CC1=CC(=NN1C)NC(=O)C2CCN(CC2)C3=NC=NC4=C3NC=N4. |
| Q: What is the InChIKey of N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide? |
| A: InChIKey of N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide is ABPHAQKLCCGPQH-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1574485-97-4? |
| A: Chinese name of 1574485-97-4 is 1574485-97-4. |
| Q: What is the molecular formula of N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide? |
| A: Molecular formula of N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide is C16H20N8O. |
| Q: What is the CAS number of N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide? |
| A: CAS number of N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide is 1574485-97-4. |
| Q: What is the English name of N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide? |
| A: The English name of N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide is N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide. |
| Q: What is the molecular weight of N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide? |
| A: Molecular weight of N-(1,5-dimethyl-1H-pyrazol-3-yl)-1-(9H-purin-6-yl)piperidine-4-carboxamide is 340.38. |