N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide
Modify Date: 2026-09-27 19:15:03
![N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide Structure](https://www.chemsrc.com/extcaspic/127/1574493-54-1.png)
N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide structure
|
Common Name | N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1574493-54-1 | Molecular Weight | 299.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H17N3OS |
|---|---|
| Molecular Weight | 299.4 |
| InChIKey | YCUOFPVGRNPQJF-UHFFFAOYSA-N |
| SMILES | Cc1nc(C(=O)NCCc2c[nH]c3ccccc23)c(C)s1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Primary screen in NF54 nanoGlo assay, in single point, at 2uM, 72h
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL4888485
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide? |
| A: Molecular formula of N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide is C16H17N3OS. |
| Q: What is the molecular weight of N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide? |
| A: Molecular weight of N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide is 299.4. |
| Q: What is the CAS number of N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide? |
| A: CAS number of N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide is 1574493-54-1. |
| Q: What is the Chinese name of 1574493-54-1? |
| A: Chinese name of 1574493-54-1 is 1574493-54-1. |
| Q: What is the English name of N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide? |
| A: The English name of N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide is N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide. |
| Q: What is the InChIKey of N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide? |
| A: InChIKey of N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide is YCUOFPVGRNPQJF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide? |
| A: SMILES notation of N-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1,3-thiazole-4-carboxamide is Cc1nc(C(=O)NCCc2c[nH]c3ccccc23)c(C)s1. |